C15H20F3N5O — CID 111108025
1-[propan-2-yl-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]amino]propan-2-ol (PubChem CID 111108025) has the molecular formula C15H20F3N5O and a molecular weight of 343.35 g/mol. Its IUPAC name is 1-[propan-2-yl-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]amino]propan-2-ol.
| Compound Name | 1-[propan-2-yl-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 111108025 |
| Molecular Formula | C15H20F3N5O |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 1-[propan-2-yl-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]amino]propan-2-ol |
| SMILES | CC(O)CN(Cc1nnnn1-c1ccc(C(F)(F)F)cc1)C(C)C |
| InChI | InChI=1S/C15H20F3N5O/c1-10(2)22(8-11(3)24)9-14-19-20-21-23(14)13-6-4-12(5-7-13)15(16,17)18/h4-7,10-11,24H,8-9H2,1-3H3 |
| InChIKey | LYHWPMQEMAPVOK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |