C15H18F3N5 — CID 87021459
1-cyclopropyl-N-methyl-N-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]ethanamine (PubChem CID 87021459) has the molecular formula C15H18F3N5 and a molecular weight of 325.34 g/mol. Its IUPAC name is 1-cyclopropyl-N-methyl-N-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]ethanamine.
| Compound Name | 1-cyclopropyl-N-methyl-N-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 87021459 |
| Molecular Formula | C15H18F3N5 |
| Molecular Weight | 325.34 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 1-cyclopropyl-N-methyl-N-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]ethanamine |
| SMILES | CC(C1CC1)N(C)Cc1nnnn1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H18F3N5/c1-10(11-3-4-11)22(2)9-14-19-20-21-23(14)13-7-5-12(6-8-13)15(16,17)18/h5-8,10-11H,3-4,9H2,1-2H3 |
| InChIKey | ZCHAMVJKSREFEC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |