C18H15F3N6 — CID 87021498
3-[[methyl-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]amino]methyl]benzonitrile (PubChem CID 87021498) has the molecular formula C18H15F3N6 and a molecular weight of 372.35 g/mol. Its IUPAC name is 3-[[methyl-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]amino]methyl]benzonitrile.
| Compound Name | 3-[[methyl-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 87021498 |
| Molecular Formula | C18H15F3N6 |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 3-[[methyl-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]amino]methyl]benzonitrile |
| SMILES | CN(Cc1cccc(C#N)c1)Cc1nnnn1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H15F3N6/c1-26(11-14-4-2-3-13(9-14)10-22)12-17-23-24-25-27(17)16-7-5-15(6-8-16)18(19,20)21/h2-9H,11-12H2,1H3 |
| InChIKey | DHSLOBFRNSFJGA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 70.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |