C16H20N6 — CID 175996234
3-[5-[[cyclohexyl(methyl)amino]methyl]tetrazol-1-yl]benzonitrile (PubChem CID 175996234) has the molecular formula C16H20N6 and a molecular weight of 296.38 g/mol. Its IUPAC name is 3-[5-[[cyclohexyl(methyl)amino]methyl]tetrazol-1-yl]benzonitrile.
| Compound Name | 3-[5-[[cyclohexyl(methyl)amino]methyl]tetrazol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 175996234 |
| Molecular Formula | C16H20N6 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 3-[5-[[cyclohexyl(methyl)amino]methyl]tetrazol-1-yl]benzonitrile |
| SMILES | CN(Cc1nnnn1-c1cccc(C#N)c1)C1CCCCC1 |
| InChI | InChI=1S/C16H20N6/c1-21(14-7-3-2-4-8-14)12-16-18-19-20-22(16)15-9-5-6-13(10-15)11-17/h5-6,9-10,14H,2-4,7-8,12H2,1H3 |
| InChIKey | OFOAIOUPYILUIJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 70.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |