C16H18F3N5O — CID 154841833
(4aS,7aR)-1-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]-3,4,4a,5,7,7a-hexahydro-2H-furo[3,4-b]pyridine (PubChem CID 154841833) has the molecular formula C16H18F3N5O and a molecular weight of 353.35 g/mol. Its IUPAC name is (4aS,7aR)-1-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]-3,4,4a,5,7,7a-hexahydro-2H-furo[3,4-b]pyridine.
| Compound Name | (4aS,7aR)-1-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]-3,4,4a,5,7,7a-hexahydro-2H-furo[3,4-b]pyridine |
|---|---|
| PubChem CID | 154841833 |
| Molecular Formula | C16H18F3N5O |
| Molecular Weight | 353.35 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | (4aS,7aR)-1-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]-3,4,4a,5,7,7a-hexahydro-2H-furo[3,4-b]pyridine |
| SMILES | FC(F)(F)c1ccc(-n2nnnc2CN2CCC[C@@H]3COC[C@@H]32)cc1 |
| InChI | InChI=1S/C16H18F3N5O/c17-16(18,19)12-3-5-13(6-4-12)24-15(20-21-22-24)8-23-7-1-2-11-9-25-10-14(11)23/h3-6,11,14H,1-2,7-10H2/t11-,14+/m1/s1 |
| InChIKey | LXXLRLPQTQTKHM-RISCZKNCSA-N |
| XLogP | 2.29 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |