C16H20F3N5S — CID 97001223
(3R)-3-methylsulfanyl-1-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]azepane (PubChem CID 97001223) has the molecular formula C16H20F3N5S and a molecular weight of 371.43 g/mol. Its IUPAC name is (3R)-3-methylsulfanyl-1-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]azepane.
| Compound Name | (3R)-3-methylsulfanyl-1-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]azepane |
|---|---|
| PubChem CID | 97001223 |
| Molecular Formula | C16H20F3N5S |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | (3R)-3-methylsulfanyl-1-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]azepane |
| SMILES | CS[C@@H]1CCCCN(Cc2nnnn2-c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C16H20F3N5S/c1-25-14-4-2-3-9-23(10-14)11-15-20-21-22-24(15)13-7-5-12(6-8-13)16(17,18)19/h5-8,14H,2-4,9-11H2,1H3/t14-/m1/s1 |
| InChIKey | MFAMRGFRUBKOFL-CQSZACIVSA-N |
| XLogP | 3.40 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |