C15H17F3N6O — CID 123925176
1-ethyl-4-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]piperazin-2-one (PubChem CID 123925176) has the molecular formula C15H17F3N6O and a molecular weight of 354.34 g/mol. Its IUPAC name is 1-ethyl-4-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]piperazin-2-one.
| Compound Name | 1-ethyl-4-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]piperazin-2-one |
|---|---|
| PubChem CID | 123925176 |
| Molecular Formula | C15H17F3N6O |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 1-ethyl-4-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]piperazin-2-one |
| SMILES | CCN1CCN(Cc2nnnn2-c2ccc(C(F)(F)F)cc2)CC1=O |
| InChI | InChI=1S/C15H17F3N6O/c1-2-23-8-7-22(10-14(23)25)9-13-19-20-21-24(13)12-5-3-11(4-6-12)15(16,17)18/h3-6H,2,7-10H2,1H3 |
| InChIKey | DCTBBIRGBOTWRH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |