C20H27F3N6O — CID 55856960
N-pentyl-1-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]piperidine-4-carboxamide (PubChem CID 55856960) has the molecular formula C20H27F3N6O and a molecular weight of 424.47 g/mol. Its IUPAC name is N-pentyl-1-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]piperidine-4-carboxamide.
| Compound Name | N-pentyl-1-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55856960 |
| Molecular Formula | C20H27F3N6O |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | N-pentyl-1-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]piperidine-4-carboxamide |
| SMILES | CCCCCNC(=O)C1CCN(Cc2nnnn2-c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C20H27F3N6O/c1-2-3-4-11-24-19(30)15-9-12-28(13-10-15)14-18-25-26-27-29(18)17-7-5-16(6-8-17)20(21,22)23/h5-8,15H,2-4,9-14H2,1H3,(H,24,30) |
| InChIKey | UFWWKCVODMUBNM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|