C16H17ClF3N — CID 11110933
1-[3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-ynyl]-3-methylpiperidine (PubChem CID 11110933) has the molecular formula C16H17ClF3N and a molecular weight of 315.77 g/mol. Its IUPAC name is 1-[3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-ynyl]-3-methylpiperidine.
| Compound Name | 1-[3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-ynyl]-3-methylpiperidine |
|---|---|
| PubChem CID | 11110933 |
| Molecular Formula | C16H17ClF3N |
| Molecular Weight | 315.77 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 1-[3-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-ynyl]-3-methylpiperidine |
| SMILES | CC1CCCN(CC#Cc2ccc(Cl)c(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C16H17ClF3N/c1-12-4-2-8-21(11-12)9-3-5-13-6-7-15(17)14(10-13)16(18,19)20/h6-7,10,12H,2,4,8-9,11H2,1H3 |
| InChIKey | DJWYPEXTSWDADQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.77 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|