C18H19N3OS2 — CID 11111090
2-[(1R,2R)-2-azido-2-phenyl-1-phenylmethoxyethyl]-1,3-dithiolane (PubChem CID 11111090) has the molecular formula C18H19N3OS2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 2-[(1R,2R)-2-azido-2-phenyl-1-phenylmethoxyethyl]-1,3-dithiolane.
| Compound Name | 2-[(1R,2R)-2-azido-2-phenyl-1-phenylmethoxyethyl]-1,3-dithiolane |
|---|---|
| PubChem CID | 11111090 |
| Molecular Formula | C18H19N3OS2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 2-[(1R,2R)-2-azido-2-phenyl-1-phenylmethoxyethyl]-1,3-dithiolane |
| SMILES | [N-]=[N+]=N[C@H](c1ccccc1)[C@@H](OCc1ccccc1)C1SCCS1 |
| InChI | InChI=1S/C18H19N3OS2/c19-21-20-16(15-9-5-2-6-10-15)17(18-23-11-12-24-18)22-13-14-7-3-1-4-8-14/h1-10,16-18H,11-13H2/t16-,17-/m1/s1 |
| InChIKey | NKHMNQDPVLMEKP-IAGOWNOFSA-N |
| XLogP | 5.43 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|