C14H27IOSi — CID 11111320
tert-butyl-[(1Z)-1-iodo-6-methylhepta-1,6-dien-3-yl]oxy-dimethylsilane (PubChem CID 11111320) has the molecular formula C14H27IOSi and a molecular weight of 366.36 g/mol. Its IUPAC name is tert-butyl-[(1Z)-1-iodo-6-methylhepta-1,6-dien-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(1Z)-1-iodo-6-methylhepta-1,6-dien-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11111320 |
| Molecular Formula | C14H27IOSi |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | tert-butyl-[(1Z)-1-iodo-6-methylhepta-1,6-dien-3-yl]oxy-dimethylsilane |
| SMILES | C=C(C)CCC(/C=C\I)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H27IOSi/c1-12(2)8-9-13(10-11-15)16-17(6,7)14(3,4)5/h10-11,13H,1,8-9H2,2-7H3/b11-10- |
| InChIKey | SMWUJBNSTZESKY-KHPPLWFESA-N |
| XLogP | 5.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|