C21H30N2O4 — CID 11111561
tert-butyl (1S,2S,6R,7R,8S)-8-(benzylamino)-4,4-dimethyl-3,5-dioxa-10-azatricyclo[5.2.1.02,6]decane-10-carboxylate (PubChem CID 11111561) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is tert-butyl (1S,2S,6R,7R,8S)-8-(benzylamino)-4,4-dimethyl-3,5-dioxa-10-azatricyclo[5.2.1.02,6]decane-10-carboxylate.
| Compound Name | tert-butyl (1S,2S,6R,7R,8S)-8-(benzylamino)-4,4-dimethyl-3,5-dioxa-10-azatricyclo[5.2.1.02,6]decane-10-carboxylate |
|---|---|
| PubChem CID | 11111561 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | tert-butyl (1S,2S,6R,7R,8S)-8-(benzylamino)-4,4-dimethyl-3,5-dioxa-10-azatricyclo[5.2.1.02,6]decane-10-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H]2[C@H]3OC(C)(C)O[C@H]3[C@@H]1C[C@@H]2NCc1ccccc1 |
| InChI | InChI=1S/C21H30N2O4/c1-20(2,3)27-19(24)23-15-11-14(22-12-13-9-7-6-8-10-13)16(23)18-17(15)25-21(4,5)26-18/h6-10,14-18,22H,11-12H2,1-5H3/t14-,15-,16+,17-,18+/m0/s1 |
| InChIKey | UWMSWGINZYIGGZ-IECFSIQFSA-N |
| XLogP | 3.06 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |