C14H20ClN3O2 — CID 111116518
4-[2-(4-chlorophenyl)-2-hydroxyethyl]-1,4-diazepane-1-carboxamide (PubChem CID 111116518) has the molecular formula C14H20ClN3O2 and a molecular weight of 297.79 g/mol. Its IUPAC name is 4-[2-(4-chlorophenyl)-2-hydroxyethyl]-1,4-diazepane-1-carboxamide.
| Compound Name | 4-[2-(4-chlorophenyl)-2-hydroxyethyl]-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 111116518 |
| Molecular Formula | C14H20ClN3O2 |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 4-[2-(4-chlorophenyl)-2-hydroxyethyl]-1,4-diazepane-1-carboxamide |
| SMILES | NC(=O)N1CCCN(CC(O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C14H20ClN3O2/c15-12-4-2-11(3-5-12)13(19)10-17-6-1-7-18(9-8-17)14(16)20/h2-5,13,19H,1,6-10H2,(H2,16,20) |
| InChIKey | AORUZNFOZWXMEE-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |