C23H14N2O4 — CID 11111731
(8,14-dioxo-15-phenyl-15,16-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17)-heptaen-3-yl) acetate (PubChem CID 11111731) has the molecular formula C23H14N2O4 and a molecular weight of 382.38 g/mol. Its IUPAC name is (8,14-dioxo-15-phenyl-15,16-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17)-heptaen-3-yl) acetate.
| Compound Name | (8,14-dioxo-15-phenyl-15,16-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17)-heptaen-3-yl) acetate |
|---|---|
| PubChem CID | 11111731 |
| Molecular Formula | C23H14N2O4 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | (8,14-dioxo-15-phenyl-15,16-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17)-heptaen-3-yl) acetate |
| SMILES | CC(=O)Oc1cccc2c1-c1nn(-c3ccccc3)c(=O)c3cccc(c13)C2=O |
| InChI | InChI=1S/C23H14N2O4/c1-13(26)29-18-12-6-10-16-20(18)21-19-15(22(16)27)9-5-11-17(19)23(28)25(24-21)14-7-3-2-4-8-14/h2-12H,1H3 |
| InChIKey | LOSALEVWYYRGIY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|