C10H20F3IN4O2S — CID 111118198
1,2-dimethyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111118198) has the molecular formula C10H20F3IN4O2S and a molecular weight of 444.26 g/mol. Its IUPAC name is 1,2-dimethyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111118198 |
| Molecular Formula | C10H20F3IN4O2S |
| Molecular Weight | 444.26 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | 1,2-dimethyl-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NC)NCC1CCN(S(=O)(=O)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C10H19F3N4O2S.HI/c1-14-9(15-2)16-7-8-3-5-17(6-4-8)20(18,19)10(11,12)13;/h8H,3-7H2,1-2H3,(H2,14,15,16);1H |
| InChIKey | DQAUVXFPMISNFG-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.26 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|