C24H38O5 — CID 11112290
methyl (5Z,9E)-10-[(4R,5S)-2,2-dimethyl-5-[(Z)-oct-2-enyl]-1,3-dioxolan-4-yl]-8-oxodeca-5,9-dienoate (PubChem CID 11112290) has the molecular formula C24H38O5 and a molecular weight of 406.56 g/mol. Its IUPAC name is methyl (5Z,9E)-10-[(4R,5S)-2,2-dimethyl-5-[(Z)-oct-2-enyl]-1,3-dioxolan-4-yl]-8-oxodeca-5,9-dienoate.
| Compound Name | methyl (5Z,9E)-10-[(4R,5S)-2,2-dimethyl-5-[(Z)-oct-2-enyl]-1,3-dioxolan-4-yl]-8-oxodeca-5,9-dienoate |
|---|---|
| PubChem CID | 11112290 |
| Molecular Formula | C24H38O5 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | methyl (5Z,9E)-10-[(4R,5S)-2,2-dimethyl-5-[(Z)-oct-2-enyl]-1,3-dioxolan-4-yl]-8-oxodeca-5,9-dienoate |
| SMILES | CCCCC/C=C\C[C@@H]1OC(C)(C)O[C@@H]1/C=C/C(=O)C/C=C\CCCC(=O)OC |
| InChI | InChI=1S/C24H38O5/c1-5-6-7-8-9-13-16-21-22(29-24(2,3)28-21)19-18-20(25)15-12-10-11-14-17-23(26)27-4/h9-10,12-13,18-19,21-22H,5-8,11,14-17H2,1-4H3/b12-10-,13-9-,19-18+/t21-,22+/m0/s1 |
| InChIKey | RBRYBTCFNMHVEE-UAPMLDLOSA-N |
| XLogP | 5.45 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|