C21H33NO3SSi — CID 11112312
tert-butyl-dimethyl-[2-[1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridin-5-yl]prop-2-enoxy]silane (PubChem CID 11112312) has the molecular formula C21H33NO3SSi and a molecular weight of 407.65 g/mol. Its IUPAC name is tert-butyl-dimethyl-[2-[1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridin-5-yl]prop-2-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[2-[1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridin-5-yl]prop-2-enoxy]silane |
|---|---|
| PubChem CID | 11112312 |
| Molecular Formula | C21H33NO3SSi |
| Molecular Weight | 407.65 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | tert-butyl-dimethyl-[2-[1-(4-methylphenyl)sulfonyl-3,6-dihydro-2H-pyridin-5-yl]prop-2-enoxy]silane |
| SMILES | C=C(CO[Si](C)(C)C(C)(C)C)C1=CCCN(S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C21H33NO3SSi/c1-17-10-12-20(13-11-17)26(23,24)22-14-8-9-19(15-22)18(2)16-25-27(6,7)21(3,4)5/h9-13H,2,8,14-16H2,1,3-7H3 |
| InChIKey | GVZQJBZKMQYIPC-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.65 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|