C15H23F2N3 — CID 111128529
1-[2-(3,5-difluorophenyl)ethyl]-2-methyl-3-pentylguanidine (PubChem CID 111128529) has the molecular formula C15H23F2N3 and a molecular weight of 283.37 g/mol. Its IUPAC name is 1-[2-(3,5-difluorophenyl)ethyl]-2-methyl-3-pentylguanidine.
| Compound Name | 1-[2-(3,5-difluorophenyl)ethyl]-2-methyl-3-pentylguanidine |
|---|---|
| PubChem CID | 111128529 |
| Molecular Formula | C15H23F2N3 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 1-[2-(3,5-difluorophenyl)ethyl]-2-methyl-3-pentylguanidine |
| SMILES | CCCCCN/C(=N\C)NCCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C15H23F2N3/c1-3-4-5-7-19-15(18-2)20-8-6-12-9-13(16)11-14(17)10-12/h9-11H,3-8H2,1-2H3,(H2,18,19,20) |
| InChIKey | WBANGHFPSAMFQL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|