C16H27F3O8SSi — CID 11113349
[(3aR,4R,7S,7aR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl] trifluoromethanesulfonate (PubChem CID 11113349) has the molecular formula C16H27F3O8SSi and a molecular weight of 464.53 g/mol. Its IUPAC name is [(3aR,4R,7S,7aR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl] trifluoromethanesulfonate.
| Compound Name | [(3aR,4R,7S,7aR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11113349 |
| Molecular Formula | C16H27F3O8SSi |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | [(3aR,4R,7S,7aR)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-6-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl] trifluoromethanesulfonate |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CO[Si](C)(C)C(C)(C)C)OC(=O)[C@H]2OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H27F3O8SSi/c1-14(2,3)29(6,7)23-8-9-10-11(26-15(4,5)25-10)12(13(20)24-9)27-28(21,22)16(17,18)19/h9-12H,8H2,1-7H3/t9-,10-,11-,12+/m1/s1 |
| InChIKey | DQIKACMNOGEXCI-KKOKHZNYSA-N |
| XLogP | 2.69 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|