C18H31F3O9SSi — CID 10815504
methyl (2R,3S,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(trifluoromethylsulfonyloxy)oxolane-2-carboxylate (PubChem CID 10815504) has the molecular formula C18H31F3O9SSi and a molecular weight of 508.58 g/mol. Its IUPAC name is methyl (2R,3S,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(trifluoromethylsulfonyloxy)oxolane-2-carboxylate.
| Compound Name | methyl (2R,3S,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(trifluoromethylsulfonyloxy)oxolane-2-carboxylate |
|---|---|
| PubChem CID | 10815504 |
| Molecular Formula | C18H31F3O9SSi |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | methyl (2R,3S,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(trifluoromethylsulfonyloxy)oxolane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1O[C@H]([C@H]2COC(C)(C)O2)[C@H](OS(=O)(=O)C(F)(F)F)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H31F3O9SSi/c1-16(2,3)32(7,8)30-13-12(29-31(23,24)18(19,20)21)11(27-14(13)15(22)25-6)10-9-26-17(4,5)28-10/h10-14H,9H2,1-8H3/t10-,11-,12+,13-,14-/m1/s1 |
| InChIKey | UMUQPAHRKWENGR-RKQHYHRCSA-N |
| XLogP | 2.70 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|