C23H43F3O9SSi2 — CID 57408327
[(1S)-1-[(3aS,6S,6aS)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4-oxo-6,6a-dihydrofuro[3,4-d][1,3]dioxol-6-yl]-2-[tert-butyl(dimethyl)silyl]oxyethyl] trifluoromethanesulfonate (PubChem CID 57408327) has the molecular formula C23H43F3O9SSi2 and a molecular weight of 608.82 g/mol. Its IUPAC name is [(1S)-1-[(3aS,6S,6aS)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4-oxo-6,6a-dihydrofuro[3,4-d][1,3]dioxol-6-yl]-2-[tert-butyl(dimethyl)silyl]oxyethyl] trifluoromethanesulfonate.
| Compound Name | [(1S)-1-[(3aS,6S,6aS)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4-oxo-6,6a-dihydrofuro[3,4-d][1,3]dioxol-6-yl]-2-[tert-butyl(dimethyl)silyl]oxyethyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 57408327 |
| Molecular Formula | C23H43F3O9SSi2 |
| Molecular Weight | 608.82 g/mol |
| Exact Mass | 608.21 |
| IUPAC Name | [(1S)-1-[(3aS,6S,6aS)-3a-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4-oxo-6,6a-dihydrofuro[3,4-d][1,3]dioxol-6-yl]-2-[tert-butyl(dimethyl)silyl]oxyethyl] trifluoromethanesulfonate |
| SMILES | CC1(C)O[C@H]2[C@@H]([C@H](CO[Si](C)(C)C(C)(C)C)OS(=O)(=O)C(F)(F)F)OC(=O)[C@@]2(CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C23H43F3O9SSi2/c1-19(2,3)37(9,10)30-13-15(34-36(28,29)23(24,25)26)16-17-22(18(27)32-16,35-21(7,8)33-17)14-31-38(11,12)20(4,5)6/h15-17H,13-14H2,1-12H3/t15-,16+,17-,22-/m0/s1 |
| InChIKey | RTOANCQLIFHKSX-GEYWLOKFSA-N |
| XLogP | 5.08 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.82 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|