C25H51F3O8SSi3 — CID 11017736
[(1R)-1-[(2S,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-oxooxolan-2-yl]-2-[tert-butyl(dimethyl)silyl]oxyethyl] trifluoromethanesulfonate (PubChem CID 11017736) has the molecular formula C25H51F3O8SSi3 and a molecular weight of 652.99 g/mol. Its IUPAC name is [(1R)-1-[(2S,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-oxooxolan-2-yl]-2-[tert-butyl(dimethyl)silyl]oxyethyl] trifluoromethanesulfonate.
| Compound Name | [(1R)-1-[(2S,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-oxooxolan-2-yl]-2-[tert-butyl(dimethyl)silyl]oxyethyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11017736 |
| Molecular Formula | C25H51F3O8SSi3 |
| Molecular Weight | 652.99 g/mol |
| Exact Mass | 652.26 |
| IUPAC Name | [(1R)-1-[(2S,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-oxooxolan-2-yl]-2-[tert-butyl(dimethyl)silyl]oxyethyl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](OS(=O)(=O)C(F)(F)F)[C@H]1OC(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H51F3O8SSi3/c1-22(2,3)38(10,11)32-16-17(34-37(30,31)25(26,27)28)18-19(35-39(12,13)23(4,5)6)20(21(29)33-18)36-40(14,15)24(7,8)9/h17-20H,16H2,1-15H3/t17-,18-,19+,20-/m1/s1 |
| InChIKey | MODAJPVBFHLHBN-YSTOQKLRSA-N |
| XLogP | 6.95 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.99 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|