C30H36O5Si — CID 11113886
methyl (E,4S)-5-[tert-butyl(diphenyl)silyl]oxy-4-(phenylmethoxymethoxy)pent-2-enoate (PubChem CID 11113886) has the molecular formula C30H36O5Si and a molecular weight of 504.70 g/mol. Its IUPAC name is methyl (E,4S)-5-[tert-butyl(diphenyl)silyl]oxy-4-(phenylmethoxymethoxy)pent-2-enoate.
| Compound Name | methyl (E,4S)-5-[tert-butyl(diphenyl)silyl]oxy-4-(phenylmethoxymethoxy)pent-2-enoate |
|---|---|
| PubChem CID | 11113886 |
| Molecular Formula | C30H36O5Si |
| Molecular Weight | 504.70 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | methyl (E,4S)-5-[tert-butyl(diphenyl)silyl]oxy-4-(phenylmethoxymethoxy)pent-2-enoate |
| SMILES | COC(=O)/C=C/[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCOCc1ccccc1 |
| InChI | InChI=1S/C30H36O5Si/c1-30(2,3)36(27-16-10-6-11-17-27,28-18-12-7-13-19-28)35-23-26(20-21-29(31)32-4)34-24-33-22-25-14-8-5-9-15-25/h5-21,26H,22-24H2,1-4H3/b21-20+/t26-/m0/s1 |
| InChIKey | TYJPTUOVMXJBIT-RJOAZTIESA-N |
| XLogP | 4.85 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.70 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|