C24H28N4O4S3 — CID 11114190
(E)-1-[5-[(E)-1-(diethylamino)-2-(5-nitrothiophen-2-yl)ethenyl]thiophen-2-yl]-N,N-diethyl-2-(5-nitrothiophen-2-yl)ethenamine (PubChem CID 11114190) has the molecular formula C24H28N4O4S3 and a molecular weight of 532.71 g/mol. Its IUPAC name is (E)-1-[5-[(E)-1-(diethylamino)-2-(5-nitrothiophen-2-yl)ethenyl]thiophen-2-yl]-N,N-diethyl-2-(5-nitrothiophen-2-yl)ethenamine.
| Compound Name | (E)-1-[5-[(E)-1-(diethylamino)-2-(5-nitrothiophen-2-yl)ethenyl]thiophen-2-yl]-N,N-diethyl-2-(5-nitrothiophen-2-yl)ethenamine |
|---|---|
| PubChem CID | 11114190 |
| Molecular Formula | C24H28N4O4S3 |
| Molecular Weight | 532.71 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | (E)-1-[5-[(E)-1-(diethylamino)-2-(5-nitrothiophen-2-yl)ethenyl]thiophen-2-yl]-N,N-diethyl-2-(5-nitrothiophen-2-yl)ethenamine |
| SMILES | CCN(CC)/C(=C/c1ccc([N+](=O)[O-])s1)c1ccc(/C(=C\c2ccc([N+](=O)[O-])s2)N(CC)CC)s1 |
| InChI | InChI=1S/C24H28N4O4S3/c1-5-25(6-2)19(15-17-9-13-23(33-17)27(29)30)21-11-12-22(35-21)20(26(7-3)8-4)16-18-10-14-24(34-18)28(31)32/h9-16H,5-8H2,1-4H3/b19-15+,20-16+ |
| InChIKey | YNXIGEGRHUEHBP-MXWIWYRXSA-N |
| XLogP | 7.37 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.71 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|