C35H60N2O3 — CID 11114396
[(3S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-(6-isocyanatohexyl)carbamate (PubChem CID 11114396) has the molecular formula C35H60N2O3 and a molecular weight of 556.88 g/mol. Its IUPAC name is [(3S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-(6-isocyanatohexyl)carbamate.
| Compound Name | [(3S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-(6-isocyanatohexyl)carbamate |
|---|---|
| PubChem CID | 11114396 |
| Molecular Formula | C35H60N2O3 |
| Molecular Weight | 556.88 g/mol |
| Exact Mass | 556.46 |
| IUPAC Name | [(3S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] N-(6-isocyanatohexyl)carbamate |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4C[C@@H](OC(=O)NCCCCCCN=C=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C35H60N2O3/c1-25(2)11-10-12-26(3)30-15-16-31-29-14-13-27-23-28(17-19-34(27,4)32(29)18-20-35(30,31)5)40-33(39)37-22-9-7-6-8-21-36-24-38/h25-32H,6-23H2,1-5H3,(H,37,39)/t26-,27?,28+,29+,30-,31+,32+,34+,35-/m1/s1 |
| InChIKey | PNPBEYZWZGVKAK-NSSPZJOFSA-N |
| XLogP | 9.10 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.88 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|