C15H28IN3O2 — CID 111155837
ethyl 1-[N'-ethyl-N-(2-methylcyclopropyl)carbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111155837) has the molecular formula C15H28IN3O2 and a molecular weight of 409.31 g/mol. Its IUPAC name is ethyl 1-[N'-ethyl-N-(2-methylcyclopropyl)carbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N'-ethyl-N-(2-methylcyclopropyl)carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111155837 |
| Molecular Formula | C15H28IN3O2 |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | ethyl 1-[N'-ethyl-N-(2-methylcyclopropyl)carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CC/N=C(/NC1CC1C)N1CCC(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C15H27N3O2.HI/c1-4-16-15(17-13-10-11(13)3)18-8-6-12(7-9-18)14(19)20-5-2;/h11-13H,4-10H2,1-3H3,(H,16,17);1H |
| InChIKey | FUWVVZJMBGLBLJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|