C16H30IN3O2 — CID 119130245
ethyl 1-[N-(2,2-dimethylcyclopropyl)-N'-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 119130245) has the molecular formula C16H30IN3O2 and a molecular weight of 423.34 g/mol. Its IUPAC name is ethyl 1-[N-(2,2-dimethylcyclopropyl)-N'-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N-(2,2-dimethylcyclopropyl)-N'-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 119130245 |
| Molecular Formula | C16H30IN3O2 |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | ethyl 1-[N-(2,2-dimethylcyclopropyl)-N'-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CC/N=C(/NC1CC1(C)C)N1CCC(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C16H29N3O2.HI/c1-5-17-15(18-13-11-16(13,3)4)19-9-7-12(8-10-19)14(20)21-6-2;/h12-13H,5-11H2,1-4H3,(H,17,18);1H |
| InChIKey | YAKPTLVHWOEGPY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|