C16H27N3O2 — CID 75533317
ethyl 1-[N-(2-methylcyclopropyl)-N'-prop-2-enylcarbamimidoyl]piperidine-4-carboxylate (PubChem CID 75533317) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is ethyl 1-[N-(2-methylcyclopropyl)-N'-prop-2-enylcarbamimidoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[N-(2-methylcyclopropyl)-N'-prop-2-enylcarbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 75533317 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | ethyl 1-[N-(2-methylcyclopropyl)-N'-prop-2-enylcarbamimidoyl]piperidine-4-carboxylate |
| SMILES | C=CC/N=C(/NC1CC1C)N1CCC(C(=O)OCC)CC1 |
| InChI | InChI=1S/C16H27N3O2/c1-4-8-17-16(18-14-11-12(14)3)19-9-6-13(7-10-19)15(20)21-5-2/h4,12-14H,1,5-11H2,2-3H3,(H,17,18) |
| InChIKey | DPOJCLLLPJUFJK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|