C15H24N2O4 — CID 3687812
ethyl 1-[4-oxo-4-(prop-2-enylamino)butanoyl]piperidine-4-carboxylate (PubChem CID 3687812) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is ethyl 1-[4-oxo-4-(prop-2-enylamino)butanoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-oxo-4-(prop-2-enylamino)butanoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 3687812 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | ethyl 1-[4-oxo-4-(prop-2-enylamino)butanoyl]piperidine-4-carboxylate |
| SMILES | C=CCNC(=O)CCC(=O)N1CCC(C(=O)OCC)CC1 |
| InChI | InChI=1S/C15H24N2O4/c1-3-9-16-13(18)5-6-14(19)17-10-7-12(8-11-17)15(20)21-4-2/h3,12H,1,4-11H2,2H3,(H,16,18) |
| InChIKey | LOFVXOQCIPIEKX-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|