C36H54N6S3 — CID 11115842
(4R,9R,18R,23R,32R,37R)-43,44,45-trithia-3,10,17,24,31,38-hexazaheptacyclo[38.2.1.112,15.126,29.04,9.018,23.032,37]pentatetraconta-1(42),12,14,26,28,40-hexaene (PubChem CID 11115842) has the molecular formula C36H54N6S3 and a molecular weight of 667.07 g/mol. Its IUPAC name is (4R,9R,18R,23R,32R,37R)-43,44,45-trithia-3,10,17,24,31,38-hexazaheptacyclo[38.2.1.112,15.126,29.04,9.018,23.032,37]pentatetraconta-1(42),12,14,26,28,40-hexaene.
| Compound Name | (4R,9R,18R,23R,32R,37R)-43,44,45-trithia-3,10,17,24,31,38-hexazaheptacyclo[38.2.1.112,15.126,29.04,9.018,23.032,37]pentatetraconta-1(42),12,14,26,28,40-hexaene |
|---|---|
| PubChem CID | 11115842 |
| Molecular Formula | C36H54N6S3 |
| Molecular Weight | 667.07 g/mol |
| Exact Mass | 666.36 |
| IUPAC Name | (4R,9R,18R,23R,32R,37R)-43,44,45-trithia-3,10,17,24,31,38-hexazaheptacyclo[38.2.1.112,15.126,29.04,9.018,23.032,37]pentatetraconta-1(42),12,14,26,28,40-hexaene |
| SMILES | c1cc2sc1CN[C@@H]1CCCC[C@H]1NCc1ccc(s1)CN[C@@H]1CCCC[C@H]1NCc1ccc(s1)CN[C@@H]1CCCC[C@H]1NC2 |
| InChI | InChI=1S/C36H54N6S3/c1-2-8-32-31(7-1)37-19-25-13-14-27(43-25)21-39-33-9-3-4-10-34(33)41-23-29-17-18-30(45-29)24-42-36-12-6-5-11-35(36)40-22-28-16-15-26(44-28)20-38-32/h13-18,31-42H,1-12,19-24H2/t31-,32-,33-,34-,35-,36-/m1/s1 |
| InChIKey | VFJUWOZVDBGUQD-HLPCWDLKSA-N |
| XLogP | 6.76 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.07 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |