C19H26N2S2 — CID 118584802
trans-(1R,2R)-1-N-(2-phenylsulfanylethyl)-2-N-(thiophen-2-ylmethyl)cyclohexane-1,2-diamine (PubChem CID 118584802) has the molecular formula C19H26N2S2 and a molecular weight of 346.56 g/mol. Its IUPAC name is trans-(1R,2R)-1-N-(2-phenylsulfanylethyl)-2-N-(thiophen-2-ylmethyl)cyclohexane-1,2-diamine.
| Compound Name | trans-(1R,2R)-1-N-(2-phenylsulfanylethyl)-2-N-(thiophen-2-ylmethyl)cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 118584802 |
| Molecular Formula | C19H26N2S2 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | trans-(1R,2R)-1-N-(2-phenylsulfanylethyl)-2-N-(thiophen-2-ylmethyl)cyclohexane-1,2-diamine |
| SMILES | c1ccc(SCCN[C@@H]2CCCC[C@H]2NCc2cccs2)cc1 |
| InChI | InChI=1S/C19H26N2S2/c1-2-7-16(8-3-1)23-14-12-20-18-10-4-5-11-19(18)21-15-17-9-6-13-22-17/h1-3,6-9,13,18-21H,4-5,10-12,14-15H2/t18-,19-/m1/s1 |
| InChIKey | YAICBPRFSYWOHV-RTBURBONSA-N |
| XLogP | 4.53 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|