C16H25BrIN3 — CID 111159276
3-[2-(4-bromophenyl)cyclopropyl]-1-butyl-1,2-dimethylguanidine;hydroiodide (PubChem CID 111159276) has the molecular formula C16H25BrIN3 and a molecular weight of 466.21 g/mol. Its IUPAC name is 3-[2-(4-bromophenyl)cyclopropyl]-1-butyl-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 3-[2-(4-bromophenyl)cyclopropyl]-1-butyl-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111159276 |
| Molecular Formula | C16H25BrIN3 |
| Molecular Weight | 466.21 g/mol |
| Exact Mass | 465.03 |
| IUPAC Name | 3-[2-(4-bromophenyl)cyclopropyl]-1-butyl-1,2-dimethylguanidine;hydroiodide |
| SMILES | CCCCN(C)/C(=N\C)NC1CC1c1ccc(Br)cc1.I |
| InChI | InChI=1S/C16H24BrN3.HI/c1-4-5-10-20(3)16(18-2)19-15-11-14(15)12-6-8-13(17)9-7-12;/h6-9,14-15H,4-5,10-11H2,1-3H3,(H,18,19);1H |
| InChIKey | GSLXPCIBWUWYAV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.21 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|