C19H36N6O3 — CID 111163567
ethyl 4-[N-[4-(4-carbamoylpiperidin-1-yl)butyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate (PubChem CID 111163567) has the molecular formula C19H36N6O3 and a molecular weight of 396.54 g/mol. Its IUPAC name is ethyl 4-[N-[4-(4-carbamoylpiperidin-1-yl)butyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[N-[4-(4-carbamoylpiperidin-1-yl)butyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111163567 |
| Molecular Formula | C19H36N6O3 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | ethyl 4-[N-[4-(4-carbamoylpiperidin-1-yl)butyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(/C(=N/C)NCCCCN2CCC(C(N)=O)CC2)CC1 |
| InChI | InChI=1S/C19H36N6O3/c1-3-28-19(27)25-14-12-24(13-15-25)18(21-2)22-8-4-5-9-23-10-6-16(7-11-23)17(20)26/h16H,3-15H2,1-2H3,(H2,20,26)(H,21,22) |
| InChIKey | WWMLQELKHBOYRL-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 103.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|