C21H41IN4O4 — CID 109391541
ethyl 1-[N-ethyl-N'-[2-[(2-methylpropan-2-yl)oxycarbonyl-propylamino]ethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 109391541) has the molecular formula C21H41IN4O4 and a molecular weight of 540.49 g/mol. Its IUPAC name is ethyl 1-[N-ethyl-N'-[2-[(2-methylpropan-2-yl)oxycarbonyl-propylamino]ethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N-ethyl-N'-[2-[(2-methylpropan-2-yl)oxycarbonyl-propylamino]ethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 109391541 |
| Molecular Formula | C21H41IN4O4 |
| Molecular Weight | 540.49 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | ethyl 1-[N-ethyl-N'-[2-[(2-methylpropan-2-yl)oxycarbonyl-propylamino]ethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCCN(CC/N=C(\NCC)N1CCC(C(=O)OCC)CC1)C(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C21H40N4O4.HI/c1-7-13-25(20(27)29-21(4,5)6)16-12-23-19(22-8-2)24-14-10-17(11-15-24)18(26)28-9-3;/h17H,7-16H2,1-6H3,(H,22,23);1H |
| InChIKey | NEKRPBJDAIKJJR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|