C19H33N3O6 — CID 11133112
ethyl 1-[(Z)-N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]piperidine-4-carboxylate (PubChem CID 11133112) has the molecular formula C19H33N3O6 and a molecular weight of 399.49 g/mol. Its IUPAC name is ethyl 1-[(Z)-N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(Z)-N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 11133112 |
| Molecular Formula | C19H33N3O6 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | ethyl 1-[(Z)-N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(/C(=N\C(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H33N3O6/c1-8-26-14(23)13-9-11-22(12-10-13)15(20-16(24)27-18(2,3)4)21-17(25)28-19(5,6)7/h13H,8-12H2,1-7H3,(H,20,21,24,25) |
| InChIKey | DGYZVKDAIMWOHL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|