C20H39IN4O4 — CID 109391533
ethyl 1-[N'-methyl-N-[2-[(2-methylpropan-2-yl)oxycarbonyl-propylamino]ethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 109391533) has the molecular formula C20H39IN4O4 and a molecular weight of 526.46 g/mol. Its IUPAC name is ethyl 1-[N'-methyl-N-[2-[(2-methylpropan-2-yl)oxycarbonyl-propylamino]ethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N'-methyl-N-[2-[(2-methylpropan-2-yl)oxycarbonyl-propylamino]ethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 109391533 |
| Molecular Formula | C20H39IN4O4 |
| Molecular Weight | 526.46 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | ethyl 1-[N'-methyl-N-[2-[(2-methylpropan-2-yl)oxycarbonyl-propylamino]ethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCCN(CCN/C(=N\C)N1CCC(C(=O)OCC)CC1)C(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C20H38N4O4.HI/c1-7-12-24(19(26)28-20(3,4)5)15-11-22-18(21-6)23-13-9-16(10-14-23)17(25)27-8-2;/h16H,7-15H2,1-6H3,(H,21,22);1H |
| InChIKey | DDTCPEHJBHJMRD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|