C20H25F3N6O2 — CID 111168900
4-(furan-2-carbonyl)-N'-methyl-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]piperazine-1-carboximidamide (PubChem CID 111168900) has the molecular formula C20H25F3N6O2 and a molecular weight of 438.45 g/mol. Its IUPAC name is 4-(furan-2-carbonyl)-N'-methyl-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]piperazine-1-carboximidamide.
| Compound Name | 4-(furan-2-carbonyl)-N'-methyl-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111168900 |
| Molecular Formula | C20H25F3N6O2 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 4-(furan-2-carbonyl)-N'-methyl-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCCNc1ccc(C(F)(F)F)cn1)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C20H25F3N6O2/c1-24-19(29-11-9-28(10-12-29)18(30)16-4-2-13-31-16)26-8-3-7-25-17-6-5-15(14-27-17)20(21,22)23/h2,4-6,13-14H,3,7-12H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | ZVXBCJAAMOOIOL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 86.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|