C11H23F3IN3O — CID 111178891
2-methyl-1-(2-methylpropyl)-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide (PubChem CID 111178891) has the molecular formula C11H23F3IN3O and a molecular weight of 397.22 g/mol. Its IUPAC name is 2-methyl-1-(2-methylpropyl)-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-methylpropyl)-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111178891 |
| Molecular Formula | C11H23F3IN3O |
| Molecular Weight | 397.22 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 2-methyl-1-(2-methylpropyl)-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCOCC(F)(F)F)NCC(C)C.I |
| InChI | InChI=1S/C11H22F3N3O.HI/c1-9(2)7-17-10(15-3)16-5-4-6-18-8-11(12,13)14;/h9H,4-8H2,1-3H3,(H2,15,16,17);1H |
| InChIKey | NWUDQWRLEOZQTE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.22 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|