C21H35ClN6 — CID 111186741
4-(3-chlorophenyl)-N-[2-(4-ethylpiperazin-1-yl)propyl]-N'-methylpiperazine-1-carboximidamide (PubChem CID 111186741) has the molecular formula C21H35ClN6 and a molecular weight of 407.01 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-N-[2-(4-ethylpiperazin-1-yl)propyl]-N'-methylpiperazine-1-carboximidamide.
| Compound Name | 4-(3-chlorophenyl)-N-[2-(4-ethylpiperazin-1-yl)propyl]-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111186741 |
| Molecular Formula | C21H35ClN6 |
| Molecular Weight | 407.01 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | 4-(3-chlorophenyl)-N-[2-(4-ethylpiperazin-1-yl)propyl]-N'-methylpiperazine-1-carboximidamide |
| SMILES | CCN1CCN(C(C)CN/C(=N\C)N2CCN(c3cccc(Cl)c3)CC2)CC1 |
| InChI | InChI=1S/C21H35ClN6/c1-4-25-8-10-26(11-9-25)18(2)17-24-21(23-3)28-14-12-27(13-15-28)20-7-5-6-19(22)16-20/h5-7,16,18H,4,8-15,17H2,1-3H3,(H,23,24) |
| InChIKey | DINUSJYESARVLE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 37.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.01 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|