C20H32BrN5O — CID 111188307
2-[[1-(3-bromophenyl)pyrrolidin-3-yl]methyl]-1-ethyl-3-(2-morpholin-4-ylethyl)guanidine (PubChem CID 111188307) has the molecular formula C20H32BrN5O and a molecular weight of 438.41 g/mol. Its IUPAC name is 2-[[1-(3-bromophenyl)pyrrolidin-3-yl]methyl]-1-ethyl-3-(2-morpholin-4-ylethyl)guanidine.
| Compound Name | 2-[[1-(3-bromophenyl)pyrrolidin-3-yl]methyl]-1-ethyl-3-(2-morpholin-4-ylethyl)guanidine |
|---|---|
| PubChem CID | 111188307 |
| Molecular Formula | C20H32BrN5O |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 2-[[1-(3-bromophenyl)pyrrolidin-3-yl]methyl]-1-ethyl-3-(2-morpholin-4-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC1CCN(c2cccc(Br)c2)C1)NCCN1CCOCC1 |
| InChI | InChI=1S/C20H32BrN5O/c1-2-22-20(23-7-9-25-10-12-27-13-11-25)24-15-17-6-8-26(16-17)19-5-3-4-18(21)14-19/h3-5,14,17H,2,6-13,15-16H2,1H3,(H2,22,23,24) |
| InChIKey | QZJWUVRVEBMCBN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|