C20H30BrN5O — CID 111927072
N-[2-[[N'-[[1-(3-bromophenyl)pyrrolidin-3-yl]methyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide (PubChem CID 111927072) has the molecular formula C20H30BrN5O and a molecular weight of 436.40 g/mol. Its IUPAC name is N-[2-[[N'-[[1-(3-bromophenyl)pyrrolidin-3-yl]methyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[[N'-[[1-(3-bromophenyl)pyrrolidin-3-yl]methyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 111927072 |
| Molecular Formula | C20H30BrN5O |
| Molecular Weight | 436.40 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | N-[2-[[N'-[[1-(3-bromophenyl)pyrrolidin-3-yl]methyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide |
| SMILES | CCN/C(=N\CC1CCN(c2cccc(Br)c2)C1)NCCNC(=O)C1CC1 |
| InChI | InChI=1S/C20H30BrN5O/c1-2-22-20(24-10-9-23-19(27)16-6-7-16)25-13-15-8-11-26(14-15)18-5-3-4-17(21)12-18/h3-5,12,15-16H,2,6-11,13-14H2,1H3,(H,23,27)(H2,22,24,25) |
| InChIKey | SXTRYMIOHDCQQF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|