C18H21N7 — CID 111193790
2-methyl-1-[(4-phenyl-1,2,4-triazol-3-yl)methyl]-3-(2-pyridin-2-ylethyl)guanidine (PubChem CID 111193790) has the molecular formula C18H21N7 and a molecular weight of 335.42 g/mol. Its IUPAC name is 2-methyl-1-[(4-phenyl-1,2,4-triazol-3-yl)methyl]-3-(2-pyridin-2-ylethyl)guanidine.
| Compound Name | 2-methyl-1-[(4-phenyl-1,2,4-triazol-3-yl)methyl]-3-(2-pyridin-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111193790 |
| Molecular Formula | C18H21N7 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 2-methyl-1-[(4-phenyl-1,2,4-triazol-3-yl)methyl]-3-(2-pyridin-2-ylethyl)guanidine |
| SMILES | C/N=C(\NCCc1ccccn1)NCc1nncn1-c1ccccc1 |
| InChI | InChI=1S/C18H21N7/c1-19-18(21-12-10-15-7-5-6-11-20-15)22-13-17-24-23-14-25(17)16-8-3-2-4-9-16/h2-9,11,14H,10,12-13H2,1H3,(H2,19,21,22) |
| InChIKey | WMMKJAKUHKXYHI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 80.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|