C23H31IN6 — CID 111892038
1-[2-(4-tert-butylphenyl)ethyl]-2-methyl-3-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111892038) has the molecular formula C23H31IN6 and a molecular weight of 518.45 g/mol. Its IUPAC name is 1-[2-(4-tert-butylphenyl)ethyl]-2-methyl-3-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(4-tert-butylphenyl)ethyl]-2-methyl-3-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111892038 |
| Molecular Formula | C23H31IN6 |
| Molecular Weight | 518.45 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | 1-[2-(4-tert-butylphenyl)ethyl]-2-methyl-3-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc(C(C)(C)C)cc1)NCc1nncn1-c1ccccc1.I |
| InChI | InChI=1S/C23H30N6.HI/c1-23(2,3)19-12-10-18(11-13-19)14-15-25-22(24-4)26-16-21-28-27-17-29(21)20-8-6-5-7-9-20;/h5-13,17H,14-16H2,1-4H3,(H2,24,25,26);1H |
| InChIKey | ODDNLXGNZQXDHY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|