C17H22IN7S — CID 111932589
2-methyl-1-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-3-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111932589) has the molecular formula C17H22IN7S and a molecular weight of 483.38 g/mol. Its IUPAC name is 2-methyl-1-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-3-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-3-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111932589 |
| Molecular Formula | C17H22IN7S |
| Molecular Weight | 483.38 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | 2-methyl-1-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-3-[(4-phenyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1csc(C)n1)NCc1nncn1-c1ccccc1.I |
| InChI | InChI=1S/C17H21N7S.HI/c1-13-22-14(11-25-13)8-9-19-17(18-2)20-10-16-23-21-12-24(16)15-6-4-3-5-7-15;/h3-7,11-12H,8-10H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | IVBYDOPSOQNNKR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 80.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|