C20H24O — CID 11119498
[(2S,3S)-5-methyl-3-phenylhex-4-en-2-yl]oxymethylbenzene (PubChem CID 11119498) has the molecular formula C20H24O and a molecular weight of 280.41 g/mol. Its IUPAC name is [(2S,3S)-5-methyl-3-phenylhex-4-en-2-yl]oxymethylbenzene.
| Compound Name | [(2S,3S)-5-methyl-3-phenylhex-4-en-2-yl]oxymethylbenzene |
|---|---|
| PubChem CID | 11119498 |
| Molecular Formula | C20H24O |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | [(2S,3S)-5-methyl-3-phenylhex-4-en-2-yl]oxymethylbenzene |
| SMILES | CC(C)=C[C@@H](c1ccccc1)[C@H](C)OCc1ccccc1 |
| InChI | InChI=1S/C20H24O/c1-16(2)14-20(19-12-8-5-9-13-19)17(3)21-15-18-10-6-4-7-11-18/h4-14,17,20H,15H2,1-3H3/t17-,20+/m0/s1 |
| InChIKey | XKRXUUORDZGTSN-FXAWDEMLSA-N |
| XLogP | 5.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|