C13H15NO6 — CID 11119512
methyl (E,4S)-5-(4-methoxyphenyl)-4-nitrooxypent-2-enoate (PubChem CID 11119512) has the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. Its IUPAC name is methyl (E,4S)-5-(4-methoxyphenyl)-4-nitrooxypent-2-enoate.
| Compound Name | methyl (E,4S)-5-(4-methoxyphenyl)-4-nitrooxypent-2-enoate |
|---|---|
| PubChem CID | 11119512 |
| Molecular Formula | C13H15NO6 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | methyl (E,4S)-5-(4-methoxyphenyl)-4-nitrooxypent-2-enoate |
| SMILES | COC(=O)/C=C/[C@H](Cc1ccc(OC)cc1)O[N+](=O)[O-] |
| InChI | InChI=1S/C13H15NO6/c1-18-11-5-3-10(4-6-11)9-12(20-14(16)17)7-8-13(15)19-2/h3-8,12H,9H2,1-2H3/b8-7+/t12-/m1/s1 |
| InChIKey | XSQZGDBWQSBTNI-ABZNLYFFSA-N |
| XLogP | 1.54 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|