C20H36N4O — CID 111212953
1-[[4-(2-methoxyethylamino)phenyl]methyl]-2-methyl-3-octan-2-ylguanidine (PubChem CID 111212953) has the molecular formula C20H36N4O and a molecular weight of 348.54 g/mol. Its IUPAC name is 1-[[4-(2-methoxyethylamino)phenyl]methyl]-2-methyl-3-octan-2-ylguanidine.
| Compound Name | 1-[[4-(2-methoxyethylamino)phenyl]methyl]-2-methyl-3-octan-2-ylguanidine |
|---|---|
| PubChem CID | 111212953 |
| Molecular Formula | C20H36N4O |
| Molecular Weight | 348.54 g/mol |
| Exact Mass | 348.29 |
| IUPAC Name | 1-[[4-(2-methoxyethylamino)phenyl]methyl]-2-methyl-3-octan-2-ylguanidine |
| SMILES | CCCCCCC(C)N/C(=N\C)NCc1ccc(NCCOC)cc1 |
| InChI | InChI=1S/C20H36N4O/c1-5-6-7-8-9-17(2)24-20(21-3)23-16-18-10-12-19(13-11-18)22-14-15-25-4/h10-13,17,22H,5-9,14-16H2,1-4H3,(H2,21,23,24) |
| InChIKey | KIZQGJYGODMGEW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 57.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|