C15H14ClFN2O2S — CID 11121384
1-[2-(4-chloro-5-fluoro-2-nitrophenyl)sulfanylphenyl]-N,N-dimethylmethanamine (PubChem CID 11121384) has the molecular formula C15H14ClFN2O2S and a molecular weight of 340.81 g/mol. Its IUPAC name is 1-[2-(4-chloro-5-fluoro-2-nitrophenyl)sulfanylphenyl]-N,N-dimethylmethanamine.
| Compound Name | 1-[2-(4-chloro-5-fluoro-2-nitrophenyl)sulfanylphenyl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 11121384 |
| Molecular Formula | C15H14ClFN2O2S |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 1-[2-(4-chloro-5-fluoro-2-nitrophenyl)sulfanylphenyl]-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1ccccc1Sc1cc(F)c(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H14ClFN2O2S/c1-18(2)9-10-5-3-4-6-14(10)22-15-8-12(17)11(16)7-13(15)19(20)21/h3-8H,9H2,1-2H3 |
| InChIKey | MRIVKIPSMKCJEX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|