C17H22BrN3O4 — CID 11122487
benzyl 4-[(2-bromoacetyl)amino]-4-(methylcarbamoyl)piperidine-1-carboxylate (PubChem CID 11122487) has the molecular formula C17H22BrN3O4 and a molecular weight of 412.28 g/mol. Its IUPAC name is benzyl 4-[(2-bromoacetyl)amino]-4-(methylcarbamoyl)piperidine-1-carboxylate.
| Compound Name | benzyl 4-[(2-bromoacetyl)amino]-4-(methylcarbamoyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11122487 |
| Molecular Formula | C17H22BrN3O4 |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | benzyl 4-[(2-bromoacetyl)amino]-4-(methylcarbamoyl)piperidine-1-carboxylate |
| SMILES | CNC(=O)C1(NC(=O)CBr)CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C17H22BrN3O4/c1-19-15(23)17(20-14(22)11-18)7-9-21(10-8-17)16(24)25-12-13-5-3-2-4-6-13/h2-6H,7-12H2,1H3,(H,19,23)(H,20,22) |
| InChIKey | YWMIPCFOXRLULT-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|