C26H17F3N2O2 — CID 11123164
(E)-3-[3-(9H-fluoren-2-yl)-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]prop-2-enoic acid (PubChem CID 11123164) has the molecular formula C26H17F3N2O2 and a molecular weight of 446.43 g/mol. Its IUPAC name is (E)-3-[3-(9H-fluoren-2-yl)-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-(9H-fluoren-2-yl)-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 11123164 |
| Molecular Formula | C26H17F3N2O2 |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | (E)-3-[3-(9H-fluoren-2-yl)-1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cn(-c2cccc(C(F)(F)F)c2)nc1-c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C26H17F3N2O2/c27-26(28,29)20-5-3-6-21(14-20)31-15-18(9-11-24(32)33)25(30-31)17-8-10-23-19(13-17)12-16-4-1-2-7-22(16)23/h1-11,13-15H,12H2,(H,32,33)/b11-9+ |
| InChIKey | SZXNAUVVWLLVLA-PKNBQFBNSA-N |
| XLogP | 6.23 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|